C24H13Cl2F3O3 — CID 3444153
1-[5-(2,3-dichlorophenyl)furan-2-yl]-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one (PubChem CID 3444153) has the molecular formula C24H13Cl2F3O3 and a molecular weight of 477.27 g/mol. Its IUPAC name is 1-[5-(2,3-dichlorophenyl)furan-2-yl]-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[5-(2,3-dichlorophenyl)furan-2-yl]-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3444153 |
| Molecular Formula | C24H13Cl2F3O3 |
| Molecular Weight | 477.27 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | 1-[5-(2,3-dichlorophenyl)furan-2-yl]-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C24H13Cl2F3O3/c25-18-6-2-5-17(23(18)26)21-11-12-22(32-21)19(30)9-7-16-8-10-20(31-16)14-3-1-4-15(13-14)24(27,28)29/h1-13H |
| InChIKey | FVSSNXRXTPKPHC-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.27 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|