C19H11Cl2FO2 — CID 3124816
3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 3124816) has the molecular formula C19H11Cl2FO2 and a molecular weight of 361.20 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3124816 |
| Molecular Formula | C19H11Cl2FO2 |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H11Cl2FO2/c20-16-3-1-2-15(19(16)21)18-11-9-14(24-18)8-10-17(23)12-4-6-13(22)7-5-12/h1-11H |
| InChIKey | MMDLFMTUOJVFTA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|