C19H10Cl2FNO3S — CID 3989383
3-[5-(2,3-dichlorophenyl)furan-2-yl]-2-(4-fluorophenyl)sulfonylprop-2-enenitrile (PubChem CID 3989383) has the molecular formula C19H10Cl2FNO3S and a molecular weight of 422.26 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-2-(4-fluorophenyl)sulfonylprop-2-enenitrile.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-2-(4-fluorophenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 3989383 |
| Molecular Formula | C19H10Cl2FNO3S |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-2-(4-fluorophenyl)sulfonylprop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2cccc(Cl)c2Cl)o1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H10Cl2FNO3S/c20-17-3-1-2-16(19(17)21)18-9-6-13(26-18)10-15(11-23)27(24,25)14-7-4-12(22)5-8-14/h1-10H |
| InChIKey | FDHPYYDUNZJKDJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 71.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|