C23H14Cl2O2 — CID 4022305
3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one (PubChem CID 4022305) has the molecular formula C23H14Cl2O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 4022305 |
| Molecular Formula | C23H14Cl2O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H14Cl2O2/c24-20-7-3-6-19(23(20)25)22-13-11-18(27-22)10-12-21(26)17-9-8-15-4-1-2-5-16(15)14-17/h1-14H |
| InChIKey | JLODBLUMNHZMOL-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|