C22H16ClNO4 — CID 60602506
3-[3-[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 60602506) has the molecular formula C22H16ClNO4 and a molecular weight of 393.83 g/mol. Its IUPAC name is 3-[3-[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 60602506 |
| Molecular Formula | C22H16ClNO4 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 3-[3-[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2Cl)o1)c1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C22H16ClNO4/c23-19-7-2-1-6-18(19)21-11-9-17(28-21)8-10-20(25)15-4-3-5-16(14-15)24-12-13-27-22(24)26/h1-11,14H,12-13H2/b10-8+ |
| InChIKey | AXYUJLPVUMZXEI-CSKARUKUSA-N |
| XLogP | 5.45 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|