C20H19NO6 — CID 129407104
3-[3-[(Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 129407104) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 3-[3-[(Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-[(Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 129407104 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-[3-[(Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | COc1cc(/C=C\C(=O)c2cccc(N3CCOC3=O)c2)cc(OC)c1O |
| InChI | InChI=1S/C20H19NO6/c1-25-17-10-13(11-18(26-2)19(17)23)6-7-16(22)14-4-3-5-15(12-14)21-8-9-27-20(21)24/h3-7,10-12,23H,8-9H2,1-2H3/b7-6- |
| InChIKey | NMSHSSCVENBIGV-SREVYHEPSA-N |
| XLogP | 3.26 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|