C24H20N2O5S — CID 67343417
3-[3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]phenyl]-5-thiophen-2-yl-1H-imidazol-2-one (PubChem CID 67343417) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is 3-[3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]phenyl]-5-thiophen-2-yl-1H-imidazol-2-one.
| Compound Name | 3-[3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]phenyl]-5-thiophen-2-yl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 67343417 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 3-[3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]phenyl]-5-thiophen-2-yl-1H-imidazol-2-one |
| SMILES | COc1cc(/C=C/C(=O)c2cccc(-n3cc(-c4cccs4)[nH]c3=O)c2)cc(OC)c1O |
| InChI | InChI=1S/C24H20N2O5S/c1-30-20-11-15(12-21(31-2)23(20)28)8-9-19(27)16-5-3-6-17(13-16)26-14-18(25-24(26)29)22-7-4-10-32-22/h3-14,28H,1-2H3,(H,25,29)/b9-8+ |
| InChIKey | SELDFOFNTKVJOX-CMDGGOBGSA-N |
| XLogP | 4.51 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|