C23H17ClN2O4 — CID 77275878
5-(5-chlorofuran-2-yl)-3-[3-[3-(4-methoxyphenyl)prop-2-enoyl]phenyl]-1H-imidazol-2-one (PubChem CID 77275878) has the molecular formula C23H17ClN2O4 and a molecular weight of 420.85 g/mol. Its IUPAC name is 5-(5-chlorofuran-2-yl)-3-[3-[3-(4-methoxyphenyl)prop-2-enoyl]phenyl]-1H-imidazol-2-one.
| Compound Name | 5-(5-chlorofuran-2-yl)-3-[3-[3-(4-methoxyphenyl)prop-2-enoyl]phenyl]-1H-imidazol-2-one |
|---|---|
| PubChem CID | 77275878 |
| Molecular Formula | C23H17ClN2O4 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 5-(5-chlorofuran-2-yl)-3-[3-[3-(4-methoxyphenyl)prop-2-enoyl]phenyl]-1H-imidazol-2-one |
| SMILES | COc1ccc(C=CC(=O)c2cccc(-n3cc(-c4ccc(Cl)o4)[nH]c3=O)c2)cc1 |
| InChI | InChI=1S/C23H17ClN2O4/c1-29-18-8-5-15(6-9-18)7-10-20(27)16-3-2-4-17(13-16)26-14-19(25-23(26)28)21-11-12-22(24)30-21/h2-14H,1H3,(H,25,28) |
| InChIKey | CRWDUQWQPQZSCV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|