C29H22N2O4 — CID 67340867
3-[3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-5-naphthalen-2-yl-1H-imidazol-2-one (PubChem CID 67340867) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is 3-[3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-5-naphthalen-2-yl-1H-imidazol-2-one.
| Compound Name | 3-[3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-5-naphthalen-2-yl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 67340867 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 3-[3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-5-naphthalen-2-yl-1H-imidazol-2-one |
| SMILES | COc1cc(C=CC(=O)c2cccc(-n3cc(-c4ccc5ccccc5c4)[nH]c3=O)c2)ccc1O |
| InChI | InChI=1S/C29H22N2O4/c1-35-28-15-19(10-14-27(28)33)9-13-26(32)23-7-4-8-24(17-23)31-18-25(30-29(31)34)22-12-11-20-5-2-3-6-21(20)16-22/h2-18,33H,1H3,(H,30,34) |
| InChIKey | DQGPMWPVTLHTIV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|