C28H26N2O4 — CID 123896261
3-[3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-4-(3,4,5-trimethylphenyl)-1H-imidazol-2-one (PubChem CID 123896261) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-[3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-4-(3,4,5-trimethylphenyl)-1H-imidazol-2-one.
| Compound Name | 3-[3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-4-(3,4,5-trimethylphenyl)-1H-imidazol-2-one |
|---|---|
| PubChem CID | 123896261 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 3-[3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-4-(3,4,5-trimethylphenyl)-1H-imidazol-2-one |
| SMILES | COc1cc(C=CC(=O)c2cccc(-n3c(-c4cc(C)c(C)c(C)c4)c[nH]c3=O)c2)ccc1O |
| InChI | InChI=1S/C28H26N2O4/c1-17-12-22(13-18(2)19(17)3)24-16-29-28(33)30(24)23-7-5-6-21(15-23)25(31)10-8-20-9-11-26(32)27(14-20)34-4/h5-16,32H,1-4H3,(H,29,33) |
| InChIKey | AVKMIMIGXAAQGJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|