C25H21ClN2O6 — CID 123458128
3-[3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoyl]phenyl]-5-(5-chlorofuran-2-yl)-1H-imidazol-2-one (PubChem CID 123458128) has the molecular formula C25H21ClN2O6 and a molecular weight of 480.90 g/mol. Its IUPAC name is 3-[3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoyl]phenyl]-5-(5-chlorofuran-2-yl)-1H-imidazol-2-one.
| Compound Name | 3-[3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoyl]phenyl]-5-(5-chlorofuran-2-yl)-1H-imidazol-2-one |
|---|---|
| PubChem CID | 123458128 |
| Molecular Formula | C25H21ClN2O6 |
| Molecular Weight | 480.90 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 3-[3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoyl]phenyl]-5-(5-chlorofuran-2-yl)-1H-imidazol-2-one |
| SMILES | COc1cc(C=CC(=O)c2cccc(-n3cc(-c4ccc(Cl)o4)[nH]c3=O)c2)cc(CO)c1CO |
| InChI | InChI=1S/C25H21ClN2O6/c1-33-23-10-15(9-17(13-29)19(23)14-30)5-6-21(31)16-3-2-4-18(11-16)28-12-20(27-25(28)32)22-7-8-24(26)34-22/h2-12,29-30H,13-14H2,1H3,(H,27,32) |
| InChIKey | KOEJIAIOPZLIFH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|