C31H26N2O5 — CID 89432959
3-[3-[(E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoyl]phenyl]-5-naphthalen-2-yl-1H-imidazol-2-one (PubChem CID 89432959) has the molecular formula C31H26N2O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is 3-[3-[(E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoyl]phenyl]-5-naphthalen-2-yl-1H-imidazol-2-one.
| Compound Name | 3-[3-[(E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoyl]phenyl]-5-naphthalen-2-yl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 89432959 |
| Molecular Formula | C31H26N2O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 3-[3-[(E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoyl]phenyl]-5-naphthalen-2-yl-1H-imidazol-2-one |
| SMILES | COc1cc(/C=C/C(=O)c2cccc(-n3cc(-c4ccc5ccccc5c4)[nH]c3=O)c2)cc(CO)c1CO |
| InChI | InChI=1S/C31H26N2O5/c1-38-30-14-20(13-25(18-34)27(30)19-35)9-12-29(36)24-7-4-8-26(16-24)33-17-28(32-31(33)37)23-11-10-21-5-2-3-6-22(21)15-23/h2-17,34-35H,18-19H2,1H3,(H,32,37)/b12-9+ |
| InChIKey | NBHMXYBGHPUXRR-FMIVXFBMSA-N |
| XLogP | 4.88 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|