C25H21NO4 — CID 52762129
3-[3-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 52762129) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-[3-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 52762129 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 3-[3-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/c1ccccc1OCc1ccccc1)c1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C25H21NO4/c27-23(21-10-6-11-22(17-21)26-15-16-29-25(26)28)14-13-20-9-4-5-12-24(20)30-18-19-7-2-1-3-8-19/h1-14,17H,15-16,18H2/b14-13+ |
| InChIKey | LTIPBGSLPPOIBJ-BUHFOSPRSA-N |
| XLogP | 5.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|