C34H33NO3 — CID 139602210
N-(2,6-diethylphenyl)-2-[3-[3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]acetamide (PubChem CID 139602210) has the molecular formula C34H33NO3 and a molecular weight of 503.64 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[3-[3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[3-[3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 139602210 |
| Molecular Formula | C34H33NO3 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[3-[3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)Cc1cccc(C(=O)C=Cc2ccccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C34H33NO3/c1-3-27-16-11-17-28(4-2)34(27)35-33(37)23-26-14-10-18-30(22-26)31(36)21-20-29-15-8-9-19-32(29)38-24-25-12-6-5-7-13-25/h5-22H,3-4,23-24H2,1-2H3,(H,35,37) |
| InChIKey | CYFLXCZCFMELMK-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|