C35H34N2O3 — CID 139602202
N-(2,6-diethylphenyl)-2-[3-[3-[2-(3-phenylprop-2-enoxy)-3-pyridinyl]prop-2-enoyl]phenyl]acetamide (PubChem CID 139602202) has the molecular formula C35H34N2O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[3-[3-[2-(3-phenylprop-2-enoxy)-3-pyridinyl]prop-2-enoyl]phenyl]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[3-[3-[2-(3-phenylprop-2-enoxy)-3-pyridinyl]prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 139602202 |
| Molecular Formula | C35H34N2O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[3-[3-[2-(3-phenylprop-2-enoxy)-3-pyridinyl]prop-2-enoyl]phenyl]acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)Cc1cccc(C(=O)C=Cc2cccnc2OCC=Cc2ccccc2)c1 |
| InChI | InChI=1S/C35H34N2O3/c1-3-28-16-9-17-29(4-2)34(28)37-33(39)25-27-14-8-18-31(24-27)32(38)21-20-30-19-10-22-36-35(30)40-23-11-15-26-12-6-5-7-13-26/h5-22,24H,3-4,23,25H2,1-2H3,(H,37,39) |
| InChIKey | MMESARRGQWJSSR-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|