C35H35NO3S — CID 139602184
N-(2,6-diethylphenyl)-2-[3-[3-[2-(2-phenylsulfanylethoxy)phenyl]prop-2-enoyl]phenyl]acetamide (PubChem CID 139602184) has the molecular formula C35H35NO3S and a molecular weight of 549.74 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[3-[3-[2-(2-phenylsulfanylethoxy)phenyl]prop-2-enoyl]phenyl]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[3-[3-[2-(2-phenylsulfanylethoxy)phenyl]prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 139602184 |
| Molecular Formula | C35H35NO3S |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[3-[3-[2-(2-phenylsulfanylethoxy)phenyl]prop-2-enoyl]phenyl]acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)Cc1cccc(C(=O)C=Cc2ccccc2OCCSc2ccccc2)c1 |
| InChI | InChI=1S/C35H35NO3S/c1-3-27-14-11-15-28(4-2)35(27)36-34(38)25-26-12-10-16-30(24-26)32(37)21-20-29-13-8-9-19-33(29)39-22-23-40-31-17-6-5-7-18-31/h5-21,24H,3-4,22-23,25H2,1-2H3,(H,36,38) |
| InChIKey | MTHQIRLKDBHAPE-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|