C31H32O9 — CID 175354946
3-[2-[3-[3-(carboxymethyl)phenyl]-3-oxoprop-1-enyl]-6-[4-(4-methoxyphenoxy)butoxy]phenoxy]propanoic acid (PubChem CID 175354946) has the molecular formula C31H32O9 and a molecular weight of 548.59 g/mol. Its IUPAC name is 3-[2-[3-[3-(carboxymethyl)phenyl]-3-oxoprop-1-enyl]-6-[4-(4-methoxyphenoxy)butoxy]phenoxy]propanoic acid.
| Compound Name | 3-[2-[3-[3-(carboxymethyl)phenyl]-3-oxoprop-1-enyl]-6-[4-(4-methoxyphenoxy)butoxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 175354946 |
| Molecular Formula | C31H32O9 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 3-[2-[3-[3-(carboxymethyl)phenyl]-3-oxoprop-1-enyl]-6-[4-(4-methoxyphenoxy)butoxy]phenoxy]propanoic acid |
| SMILES | COc1ccc(OCCCCOc2cccc(C=CC(=O)c3cccc(CC(=O)O)c3)c2OCCC(=O)O)cc1 |
| InChI | InChI=1S/C31H32O9/c1-37-25-11-13-26(14-12-25)38-17-2-3-18-39-28-9-5-7-23(31(28)40-19-16-29(33)34)10-15-27(32)24-8-4-6-22(20-24)21-30(35)36/h4-15,20H,2-3,16-19,21H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | VAIGRIVYTPBDOJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|