C26H24O5S — CID 16560822
2-[[2-methoxy-5-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetic acid (PubChem CID 16560822) has the molecular formula C26H24O5S and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[2-methoxy-5-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 16560822 |
| Molecular Formula | C26H24O5S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-[[2-methoxy-5-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetic acid |
| SMILES | COc1ccc(C(=O)/C=C/c2ccccc2OCc2ccccc2)cc1CSCC(=O)O |
| InChI | InChI=1S/C26H24O5S/c1-30-24-14-12-21(15-22(24)17-32-18-26(28)29)23(27)13-11-20-9-5-6-10-25(20)31-16-19-7-3-2-4-8-19/h2-15H,16-18H2,1H3,(H,28,29)/b13-11+ |
| InChIKey | CAOLULPRSJSQPJ-ACCUITESSA-N |
| XLogP | 5.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|