C24H28O6S — CID 16564086
2-[[5-[(E)-3-(3-butoxy-4-methoxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid (PubChem CID 16564086) has the molecular formula C24H28O6S and a molecular weight of 444.55 g/mol. Its IUPAC name is 2-[[5-[(E)-3-(3-butoxy-4-methoxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[5-[(E)-3-(3-butoxy-4-methoxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 16564086 |
| Molecular Formula | C24H28O6S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-[[5-[(E)-3-(3-butoxy-4-methoxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid |
| SMILES | CCCCOc1cc(/C=C/C(=O)c2ccc(OC)c(CSCC(=O)O)c2)ccc1OC |
| InChI | InChI=1S/C24H28O6S/c1-4-5-12-30-23-13-17(7-10-22(23)29-3)6-9-20(25)18-8-11-21(28-2)19(14-18)15-31-16-24(26)27/h6-11,13-14H,4-5,12,15-16H2,1-3H3,(H,26,27)/b9-6+ |
| InChIKey | FSFSTDCXCBZROM-RMKNXTFCSA-N |
| XLogP | 5.10 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|