C27H28O4 — CID 54377842
3-(2-hydroxy-5-pentoxy-4-phenylmethoxyphenyl)-1-phenylprop-2-en-1-one (PubChem CID 54377842) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-(2-hydroxy-5-pentoxy-4-phenylmethoxyphenyl)-1-phenylprop-2-en-1-one.
| Compound Name | 3-(2-hydroxy-5-pentoxy-4-phenylmethoxyphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 54377842 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3-(2-hydroxy-5-pentoxy-4-phenylmethoxyphenyl)-1-phenylprop-2-en-1-one |
| SMILES | CCCCCOc1cc(C=CC(=O)c2ccccc2)c(O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H28O4/c1-2-3-10-17-30-26-18-23(15-16-24(28)22-13-8-5-9-14-22)25(29)19-27(26)31-20-21-11-6-4-7-12-21/h4-9,11-16,18-19,29H,2-3,10,17,20H2,1H3 |
| InChIKey | UXUQVAJOPMDUOA-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|