C23H19Cl2NO3 — CID 47016523
(E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(3-morpholin-4-ylphenyl)prop-2-en-1-one (PubChem CID 47016523) has the molecular formula C23H19Cl2NO3 and a molecular weight of 428.32 g/mol. Its IUPAC name is (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(3-morpholin-4-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(3-morpholin-4-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 47016523 |
| Molecular Formula | C23H19Cl2NO3 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(3-morpholin-4-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)c(Cl)c2)o1)c1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C23H19Cl2NO3/c24-20-7-4-17(15-21(20)25)23-9-6-19(29-23)5-8-22(27)16-2-1-3-18(14-16)26-10-12-28-13-11-26/h1-9,14-15H,10-13H2/b8-5+ |
| InChIKey | YGQOEVZOLKDXFJ-VMPITWQZSA-N |
| XLogP | 5.99 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|