C24H14Cl2O5 — CID 4710043
4-[5-[3-[5-(2,3-dichlorophenyl)furan-2-yl]-3-oxoprop-1-enyl]furan-2-yl]benzoic acid (PubChem CID 4710043) has the molecular formula C24H14Cl2O5 and a molecular weight of 453.28 g/mol. Its IUPAC name is 4-[5-[3-[5-(2,3-dichlorophenyl)furan-2-yl]-3-oxoprop-1-enyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[3-[5-(2,3-dichlorophenyl)furan-2-yl]-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4710043 |
| Molecular Formula | C24H14Cl2O5 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 4-[5-[3-[5-(2,3-dichlorophenyl)furan-2-yl]-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C=CC(=O)c3ccc(-c4cccc(Cl)c4Cl)o3)o2)cc1 |
| InChI | InChI=1S/C24H14Cl2O5/c25-18-3-1-2-17(23(18)26)21-12-13-22(31-21)19(27)10-8-16-9-11-20(30-16)14-4-6-15(7-5-14)24(28)29/h1-13H,(H,28,29) |
| InChIKey | NZDUTBVBKWTBIX-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|