C25H18Cl2N2O2 — CID 45102865
(E)-1-(5-chloro-2-hydroxy-4-methylphenyl)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-en-1-one (PubChem CID 45102865) has the molecular formula C25H18Cl2N2O2 and a molecular weight of 449.34 g/mol. Its IUPAC name is (E)-1-(5-chloro-2-hydroxy-4-methylphenyl)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(5-chloro-2-hydroxy-4-methylphenyl)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 45102865 |
| Molecular Formula | C25H18Cl2N2O2 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | (E)-1-(5-chloro-2-hydroxy-4-methylphenyl)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-en-1-one |
| SMILES | Cc1cc(O)c(C(=O)/C=C/c2cn(-c3ccccc3)nc2-c2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C25H18Cl2N2O2/c1-16-13-24(31)21(14-22(16)27)23(30)12-9-18-15-29(20-5-3-2-4-6-20)28-25(18)17-7-10-19(26)11-8-17/h2-15,31H,1H3/b12-9+ |
| InChIKey | FHIMRQAXEGGHKF-FMIVXFBMSA-N |
| XLogP | 6.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|