C26H16ClNO3 — CID 4709596
1-[5-(2-chlorophenyl)furan-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-en-1-one (PubChem CID 4709596) has the molecular formula C26H16ClNO3 and a molecular weight of 425.87 g/mol. Its IUPAC name is 1-[5-(2-chlorophenyl)furan-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-en-1-one.
| Compound Name | 1-[5-(2-chlorophenyl)furan-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4709596 |
| Molecular Formula | C26H16ClNO3 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 1-[5-(2-chlorophenyl)furan-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc2noc(-c3ccccc3)c2c1)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C26H16ClNO3/c27-21-9-5-4-8-19(21)24-14-15-25(30-24)23(29)13-11-17-10-12-22-20(16-17)26(31-28-22)18-6-2-1-3-7-18/h1-16H |
| InChIKey | MQNUZBVXIIVPSN-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|