C22H15ClN2O2 — CID 6196005
(E)-1-[5-(2-chlorophenyl)furan-2-yl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-en-1-one (PubChem CID 6196005) has the molecular formula C22H15ClN2O2 and a molecular weight of 374.83 g/mol. Its IUPAC name is (E)-1-[5-(2-chlorophenyl)furan-2-yl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[5-(2-chlorophenyl)furan-2-yl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6196005 |
| Molecular Formula | C22H15ClN2O2 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | (E)-1-[5-(2-chlorophenyl)furan-2-yl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn[nH]c1-c1ccccc1)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C22H15ClN2O2/c23-18-9-5-4-8-17(18)20-12-13-21(27-20)19(26)11-10-16-14-24-25-22(16)15-6-2-1-3-7-15/h1-14H,(H,24,25)/b11-10+ |
| InChIKey | CXQFDMYYIWTEMA-ZHACJKMWSA-N |
| XLogP | 5.89 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|