C23H14F3N3O4 — CID 6196335
(E)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]-1-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one (PubChem CID 6196335) has the molecular formula C23H14F3N3O4 and a molecular weight of 453.38 g/mol. Its IUPAC name is (E)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]-1-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]-1-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6196335 |
| Molecular Formula | C23H14F3N3O4 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | (E)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]-1-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn[nH]c1-c1cccc([N+](=O)[O-])c1)c1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C23H14F3N3O4/c24-23(25,26)17-5-1-3-14(11-17)20-9-10-21(33-20)19(30)8-7-16-13-27-28-22(16)15-4-2-6-18(12-15)29(31)32/h1-13H,(H,27,28)/b8-7+ |
| InChIKey | LBXDNRSQRRYUGW-BQYQJAHWSA-N |
| XLogP | 6.16 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|