C23H16N4O5 — CID 18830583
N-[3-[(E)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enoyl]phenyl]furan-2-carboxamide (PubChem CID 18830583) has the molecular formula C23H16N4O5 and a molecular weight of 428.40 g/mol. Its IUPAC name is N-[3-[(E)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(E)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18830583 |
| Molecular Formula | C23H16N4O5 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[3-[(E)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(/C=C/c1cn[nH]c1-c1cccc([N+](=O)[O-])c1)c1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C23H16N4O5/c28-20(15-4-1-6-18(12-15)25-23(29)21-8-3-11-32-21)10-9-17-14-24-26-22(17)16-5-2-7-19(13-16)27(30)31/h1-14H,(H,24,26)(H,25,29)/b10-9+ |
| InChIKey | XVLCBNKWYBRBLR-MDZDMXLPSA-N |
| XLogP | 4.73 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|