methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate

C17H12ClNO3 — CID 945358

IUPACmethyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate
SMILESCOC(=O)C=Cc1ccc2noc(-c3ccc(Cl)cc3)c2c1
InChIInChI=1S/C17H12ClNO3/c1-21-16(20)9-3-11-2-8-15-14(10-11)17(22-19-15)12-4-6-13(18)7-5-12/h2-10H,1H3
InChIKeyOBDRTEKNFJWXJM-UHFFFAOYSA-N
MW313.74 g/mol
LogP4.33
Rot. Bonds3

About methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate

methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate (PubChem CID 945358) has the molecular formula C17H12ClNO3 and a molecular weight of 313.74 g/mol. Its IUPAC name is methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate.

Molecular Properties

Compound Namemethyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate
PubChem CID945358
Molecular FormulaC17H12ClNO3
Molecular Weight313.74 g/mol
Exact Mass313.05
IUPAC Namemethyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate
SMILESCOC(=O)C=Cc1ccc2noc(-c3ccc(Cl)cc3)c2c1
InChIInChI=1S/C17H12ClNO3/c1-21-16(20)9-3-11-2-8-15-14(10-11)17(22-19-15)12-4-6-13(18)7-5-12/h2-10H,1H3
InChIKeyOBDRTEKNFJWXJM-UHFFFAOYSA-N
XLogP4.33
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.74
LogP ≤ 54.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate?
The IUPAC name of methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate (CID 945358) is methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate.
What is the SMILES notation for methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate?
The canonical SMILES for methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate is COC(=O)C=Cc1ccc2noc(-c3ccc(Cl)cc3)c2c1.
What is the InChIKey of methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate?
The InChIKey is OBDRTEKNFJWXJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClNO3/c1-21-16(20)9-3-11-2-8-15-14(10-11)17(22-19-15)12-4-6-13(18)7-5-12/h2-10H,1H3.
What are the key properties of methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate?
methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate has a molecular weight of 313.74 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]prop-2-enoate is sourced from PubChem (CID 945358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).