C17H16ClNO — CID 58331706
5-tert-butyl-3-(4-chlorophenyl)-2,1-benzoxazole (PubChem CID 58331706) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is 5-tert-butyl-3-(4-chlorophenyl)-2,1-benzoxazole.
| Compound Name | 5-tert-butyl-3-(4-chlorophenyl)-2,1-benzoxazole |
|---|---|
| PubChem CID | 58331706 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-tert-butyl-3-(4-chlorophenyl)-2,1-benzoxazole |
| SMILES | CC(C)(C)c1ccc2noc(-c3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C17H16ClNO/c1-17(2,3)12-6-9-15-14(10-12)16(20-19-15)11-4-7-13(18)8-5-11/h4-10H,1-3H3 |
| InChIKey | WKUITXLYNWNNCZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |