C23H16ClN2O+ — CID 123183108
3-(4-chlorophenyl)-5-[1-(4-methylphenyl)azet-1-ium-2-yl]-2,1-benzoxazole (PubChem CID 123183108) has the molecular formula C23H16ClN2O+ and a molecular weight of 371.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[1-(4-methylphenyl)azet-1-ium-2-yl]-2,1-benzoxazole.
| Compound Name | 3-(4-chlorophenyl)-5-[1-(4-methylphenyl)azet-1-ium-2-yl]-2,1-benzoxazole |
|---|---|
| PubChem CID | 123183108 |
| Molecular Formula | C23H16ClN2O+ |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[1-(4-methylphenyl)azet-1-ium-2-yl]-2,1-benzoxazole |
| SMILES | Cc1ccc([N+]2=C(c3ccc4noc(-c5ccc(Cl)cc5)c4c3)C=C2)cc1 |
| InChI | InChI=1S/C23H16ClN2O/c1-15-2-9-19(10-3-15)26-13-12-22(26)17-6-11-21-20(14-17)23(27-25-21)16-4-7-18(24)8-5-16/h2-14H,1H3/q+1 |
| InChIKey | VHOBDURBPNQDJL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 29.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|