C23H16FN2O2+ — CID 123624046
5-[1-(4-fluorophenyl)azet-1-ium-2-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole (PubChem CID 123624046) has the molecular formula C23H16FN2O2+ and a molecular weight of 371.39 g/mol. Its IUPAC name is 5-[1-(4-fluorophenyl)azet-1-ium-2-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole.
| Compound Name | 5-[1-(4-fluorophenyl)azet-1-ium-2-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole |
|---|---|
| PubChem CID | 123624046 |
| Molecular Formula | C23H16FN2O2+ |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 5-[1-(4-fluorophenyl)azet-1-ium-2-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole |
| SMILES | COc1ccc(-c2onc3ccc(C4=[N+](c5ccc(F)cc5)C=C4)cc23)cc1 |
| InChI | InChI=1S/C23H16FN2O2/c1-27-19-9-2-15(3-10-19)23-20-14-16(4-11-21(20)25-28-23)22-12-13-26(22)18-7-5-17(24)6-8-18/h2-14H,1H3/q+1 |
| InChIKey | QKSCSNGYZGCXSQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|