C22H15FN2O3 — CID 46350554
N-(3-acetylphenyl)-3-(4-fluorophenyl)-2,1-benzoxazole-5-carboxamide (PubChem CID 46350554) has the molecular formula C22H15FN2O3 and a molecular weight of 374.37 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3-(4-fluorophenyl)-2,1-benzoxazole-5-carboxamide.
| Compound Name | N-(3-acetylphenyl)-3-(4-fluorophenyl)-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 46350554 |
| Molecular Formula | C22H15FN2O3 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-(3-acetylphenyl)-3-(4-fluorophenyl)-2,1-benzoxazole-5-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc3noc(-c4ccc(F)cc4)c3c2)c1 |
| InChI | InChI=1S/C22H15FN2O3/c1-13(26)15-3-2-4-18(11-15)24-22(27)16-7-10-20-19(12-16)21(28-25-20)14-5-8-17(23)9-6-14/h2-12H,1H3,(H,24,27) |
| InChIKey | VSADVJUWWTTZLV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |