C15H11FN2O4S — CID 146154705
3-(4-fluorophenyl)-N-methylsulfonyl-2,1-benzoxazole-5-carboxamide (PubChem CID 146154705) has the molecular formula C15H11FN2O4S and a molecular weight of 334.33 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-methylsulfonyl-2,1-benzoxazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-methylsulfonyl-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 146154705 |
| Molecular Formula | C15H11FN2O4S |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 3-(4-fluorophenyl)-N-methylsulfonyl-2,1-benzoxazole-5-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc2noc(-c3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C15H11FN2O4S/c1-23(20,21)18-15(19)10-4-7-13-12(8-10)14(22-17-13)9-2-5-11(16)6-3-9/h2-8H,1H3,(H,18,19) |
| InChIKey | LRHYWYIJYAHIIE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |