C23H20N2O4S — CID 17478939
N-[1-(4-methylsulfonylphenyl)ethyl]-3-phenyl-2,1-benzoxazole-5-carboxamide (PubChem CID 17478939) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[1-(4-methylsulfonylphenyl)ethyl]-3-phenyl-2,1-benzoxazole-5-carboxamide.
| Compound Name | N-[1-(4-methylsulfonylphenyl)ethyl]-3-phenyl-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 17478939 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[1-(4-methylsulfonylphenyl)ethyl]-3-phenyl-2,1-benzoxazole-5-carboxamide |
| SMILES | CC(NC(=O)c1ccc2noc(-c3ccccc3)c2c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H20N2O4S/c1-15(16-8-11-19(12-9-16)30(2,27)28)24-23(26)18-10-13-21-20(14-18)22(29-25-21)17-6-4-3-5-7-17/h3-15H,1-2H3,(H,24,26) |
| InChIKey | ZFTQWRQCGRWVFA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |