C24H20N2O4 — CID 24516885
methyl 3-phenyl-3-[(3-phenyl-2,1-benzoxazole-5-carbonyl)amino]propanoate (PubChem CID 24516885) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is methyl 3-phenyl-3-[(3-phenyl-2,1-benzoxazole-5-carbonyl)amino]propanoate.
| Compound Name | methyl 3-phenyl-3-[(3-phenyl-2,1-benzoxazole-5-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 24516885 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | methyl 3-phenyl-3-[(3-phenyl-2,1-benzoxazole-5-carbonyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc2noc(-c3ccccc3)c2c1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O4/c1-29-22(27)15-21(16-8-4-2-5-9-16)25-24(28)18-12-13-20-19(14-18)23(30-26-20)17-10-6-3-7-11-17/h2-14,21H,15H2,1H3,(H,25,28) |
| InChIKey | NXSGSIQCCMVFPM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |