C22H13F2N2O+ — CID 123281341
3-(3-fluorophenyl)-5-[1-(4-fluorophenyl)azet-1-ium-2-yl]-2,1-benzoxazole (PubChem CID 123281341) has the molecular formula C22H13F2N2O+ and a molecular weight of 359.36 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5-[1-(4-fluorophenyl)azet-1-ium-2-yl]-2,1-benzoxazole.
| Compound Name | 3-(3-fluorophenyl)-5-[1-(4-fluorophenyl)azet-1-ium-2-yl]-2,1-benzoxazole |
|---|---|
| PubChem CID | 123281341 |
| Molecular Formula | C22H13F2N2O+ |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 3-(3-fluorophenyl)-5-[1-(4-fluorophenyl)azet-1-ium-2-yl]-2,1-benzoxazole |
| SMILES | Fc1ccc([N+]2=C(c3ccc4noc(-c5cccc(F)c5)c4c3)C=C2)cc1 |
| InChI | InChI=1S/C22H13F2N2O/c23-16-5-7-18(8-6-16)26-11-10-21(26)14-4-9-20-19(13-14)22(27-25-20)15-2-1-3-17(24)12-15/h1-13H/q+1 |
| InChIKey | RWTUZYXKKXLAEO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|