C26H20N2O — CID 7182128
4-[(3R)-3-naphthalen-1-yl-5-phenyl-3,4-dihydropyrazol-2-yl]benzaldehyde (PubChem CID 7182128) has the molecular formula C26H20N2O and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-[(3R)-3-naphthalen-1-yl-5-phenyl-3,4-dihydropyrazol-2-yl]benzaldehyde.
| Compound Name | 4-[(3R)-3-naphthalen-1-yl-5-phenyl-3,4-dihydropyrazol-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 7182128 |
| Molecular Formula | C26H20N2O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-[(3R)-3-naphthalen-1-yl-5-phenyl-3,4-dihydropyrazol-2-yl]benzaldehyde |
| SMILES | O=Cc1ccc(N2N=C(c3ccccc3)C[C@@H]2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H20N2O/c29-18-19-13-15-22(16-14-19)28-26(17-25(27-28)21-8-2-1-3-9-21)24-12-6-10-20-7-4-5-11-23(20)24/h1-16,18,26H,17H2/t26-/m1/s1 |
| InChIKey | DKZOVUXJUUZGJN-AREMUKBSSA-N |
| XLogP | 6.01 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|