C27H31NO4S — CID 122394104
[(6S,8aS)-5,5,7-trimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,6,8a-tetrahydrocyclohepta[c]pyrrol-4-yl] acetate (PubChem CID 122394104) has the molecular formula C27H31NO4S and a molecular weight of 465.62 g/mol. Its IUPAC name is [(6S,8aS)-5,5,7-trimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,6,8a-tetrahydrocyclohepta[c]pyrrol-4-yl] acetate.
| Compound Name | [(6S,8aS)-5,5,7-trimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,6,8a-tetrahydrocyclohepta[c]pyrrol-4-yl] acetate |
|---|---|
| PubChem CID | 122394104 |
| Molecular Formula | C27H31NO4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | [(6S,8aS)-5,5,7-trimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,6,8a-tetrahydrocyclohepta[c]pyrrol-4-yl] acetate |
| SMILES | CC(=O)OC1=C2CN(S(=O)(=O)c3ccc(C)cc3)C[C@H]2C=C(C)[C@@H](c2ccccc2)C1(C)C |
| InChI | InChI=1S/C27H31NO4S/c1-18-11-13-23(14-12-18)33(30,31)28-16-22-15-19(2)25(21-9-7-6-8-10-21)27(4,5)26(24(22)17-28)32-20(3)29/h6-15,22,25H,16-17H2,1-5H3/t22-,25+/m1/s1 |
| InChIKey | SHJKEZNWMGSFKW-RDGATRHJSA-N |
| XLogP | 5.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|