C22H25NO3S — CID 135054485
(3aS,6S)-4,4-dimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,6-tetrahydropyrano[3,4-c]pyrrole (PubChem CID 135054485) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is (3aS,6S)-4,4-dimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,6-tetrahydropyrano[3,4-c]pyrrole.
| Compound Name | (3aS,6S)-4,4-dimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,6-tetrahydropyrano[3,4-c]pyrrole |
|---|---|
| PubChem CID | 135054485 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (3aS,6S)-4,4-dimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,6-tetrahydropyrano[3,4-c]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=C[C@@H](c4ccccc4)OC(C)(C)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C22H25NO3S/c1-16-9-11-19(12-10-16)27(24,25)23-14-18-13-21(17-7-5-4-6-8-17)26-22(2,3)20(18)15-23/h4-13,20-21H,14-15H2,1-3H3/t20-,21+/m1/s1 |
| InChIKey | PGALGLDYRUHORJ-RTWAWAEBSA-N |
| XLogP | 4.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|