C34H43NO4S — CID 122394109
[(6S,8aS)-7-hexyl-2-(4-methylphenyl)sulfonyl-6-phenylspiro[1,3,6,8a-tetrahydrocyclohepta[c]pyrrole-5,1'-cyclopentane]-4-yl] acetate (PubChem CID 122394109) has the molecular formula C34H43NO4S and a molecular weight of 561.79 g/mol. Its IUPAC name is [(6S,8aS)-7-hexyl-2-(4-methylphenyl)sulfonyl-6-phenylspiro[1,3,6,8a-tetrahydrocyclohepta[c]pyrrole-5,1'-cyclopentane]-4-yl] acetate.
| Compound Name | [(6S,8aS)-7-hexyl-2-(4-methylphenyl)sulfonyl-6-phenylspiro[1,3,6,8a-tetrahydrocyclohepta[c]pyrrole-5,1'-cyclopentane]-4-yl] acetate |
|---|---|
| PubChem CID | 122394109 |
| Molecular Formula | C34H43NO4S |
| Molecular Weight | 561.79 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | [(6S,8aS)-7-hexyl-2-(4-methylphenyl)sulfonyl-6-phenylspiro[1,3,6,8a-tetrahydrocyclohepta[c]pyrrole-5,1'-cyclopentane]-4-yl] acetate |
| SMILES | CCCCCCC1=C[C@@H]2CN(S(=O)(=O)c3ccc(C)cc3)CC2=C(OC(C)=O)C2(CCCC2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C34H43NO4S/c1-4-5-6-8-15-28-22-29-23-35(40(37,38)30-18-16-25(2)17-19-30)24-31(29)33(39-26(3)36)34(20-11-12-21-34)32(28)27-13-9-7-10-14-27/h7,9-10,13-14,16-19,22,29,32H,4-6,8,11-12,15,20-21,23-24H2,1-3H3/t29-,32-/m1/s1 |
| InChIKey | RUOHPTVZNCXSHV-QLWXXVCSSA-N |
| XLogP | 7.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.79 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|