C23H29NO5S — CID 10982898
[(4R,5R)-3-hexyl-2-oxo-4-phenyl-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10982898) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is [(4R,5R)-3-hexyl-2-oxo-4-phenyl-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4R,5R)-3-hexyl-2-oxo-4-phenyl-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10982898 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [(4R,5R)-3-hexyl-2-oxo-4-phenyl-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCCCCCN1C(=O)O[C@@H](COS(=O)(=O)c2ccc(C)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H29NO5S/c1-3-4-5-9-16-24-22(19-10-7-6-8-11-19)21(29-23(24)25)17-28-30(26,27)20-14-12-18(2)13-15-20/h6-8,10-15,21-22H,3-5,9,16-17H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | YTFRZLIXBSGHKP-FCHUYYIVSA-N |
| XLogP | 4.84 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|