C22H20O5S — CID 25131482
(4-oxo-2-phenyl-6,7-dihydro-5H-1-benzofuran-6-yl)methyl 4-methylbenzenesulfonate (PubChem CID 25131482) has the molecular formula C22H20O5S and a molecular weight of 396.46 g/mol. Its IUPAC name is (4-oxo-2-phenyl-6,7-dihydro-5H-1-benzofuran-6-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (4-oxo-2-phenyl-6,7-dihydro-5H-1-benzofuran-6-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 25131482 |
| Molecular Formula | C22H20O5S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (4-oxo-2-phenyl-6,7-dihydro-5H-1-benzofuran-6-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(=O)c3cc(-c4ccccc4)oc3C2)cc1 |
| InChI | InChI=1S/C22H20O5S/c1-15-7-9-18(10-8-15)28(24,25)26-14-16-11-20(23)19-13-21(27-22(19)12-16)17-5-3-2-4-6-17/h2-10,13,16H,11-12,14H2,1H3 |
| InChIKey | ABSVKMFVTLFRHU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|