C16H17NO4S — CID 101201279
(4-oxo-1,5,6,7-tetrahydroindol-6-yl)methyl 4-methylbenzenesulfonate (PubChem CID 101201279) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is (4-oxo-1,5,6,7-tetrahydroindol-6-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (4-oxo-1,5,6,7-tetrahydroindol-6-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101201279 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (4-oxo-1,5,6,7-tetrahydroindol-6-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(=O)c3cc[nH]c3C2)cc1 |
| InChI | InChI=1S/C16H17NO4S/c1-11-2-4-13(5-3-11)22(19,20)21-10-12-8-15-14(6-7-17-15)16(18)9-12/h2-7,12,17H,8-10H2,1H3 |
| InChIKey | HCBXRUOPKMNQAX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|