C29H38N2O4S2 — CID 122234258
9-hexyl-1,4-bis-(4-methylphenyl)sulfonyl-3,5,6,7-tetrahydro-2H-1,4-benzodiazepine (PubChem CID 122234258) has the molecular formula C29H38N2O4S2 and a molecular weight of 542.77 g/mol. Its IUPAC name is 9-hexyl-1,4-bis-(4-methylphenyl)sulfonyl-3,5,6,7-tetrahydro-2H-1,4-benzodiazepine.
| Compound Name | 9-hexyl-1,4-bis-(4-methylphenyl)sulfonyl-3,5,6,7-tetrahydro-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 122234258 |
| Molecular Formula | C29H38N2O4S2 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 9-hexyl-1,4-bis-(4-methylphenyl)sulfonyl-3,5,6,7-tetrahydro-2H-1,4-benzodiazepine |
| SMILES | CCCCCCC1=CCCC2=C1N(S(=O)(=O)c1ccc(C)cc1)CCN(S(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C29H38N2O4S2/c1-4-5-6-7-9-25-10-8-11-26-22-30(36(32,33)27-16-12-23(2)13-17-27)20-21-31(29(25)26)37(34,35)28-18-14-24(3)15-19-28/h10,12-19H,4-9,11,20-22H2,1-3H3 |
| InChIKey | HSGNXVYSZYWICI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|