C20H29NO2S — CID 102434478
8-hexyl-2-(4-methylphenyl)sulfonyl-2-azabicyclo[4.2.0]oct-1(8)-ene (PubChem CID 102434478) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is 8-hexyl-2-(4-methylphenyl)sulfonyl-2-azabicyclo[4.2.0]oct-1(8)-ene.
| Compound Name | 8-hexyl-2-(4-methylphenyl)sulfonyl-2-azabicyclo[4.2.0]oct-1(8)-ene |
|---|---|
| PubChem CID | 102434478 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 8-hexyl-2-(4-methylphenyl)sulfonyl-2-azabicyclo[4.2.0]oct-1(8)-ene |
| SMILES | CCCCCCC1=C2C(CCCN2S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H29NO2S/c1-3-4-5-6-8-17-15-18-9-7-14-21(20(17)18)24(22,23)19-12-10-16(2)11-13-19/h10-13,18H,3-9,14-15H2,1-2H3 |
| InChIKey | HYABLPQHXWVFKW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|