C21H31NO2S — CID 10618615
(8R,8aS)-8-methyl-6-(4-methylphenyl)sulfonyl-5-pentyl-1,2,3,7,8,8a-hexahydroindolizine (PubChem CID 10618615) has the molecular formula C21H31NO2S and a molecular weight of 361.55 g/mol. Its IUPAC name is (8R,8aS)-8-methyl-6-(4-methylphenyl)sulfonyl-5-pentyl-1,2,3,7,8,8a-hexahydroindolizine.
| Compound Name | (8R,8aS)-8-methyl-6-(4-methylphenyl)sulfonyl-5-pentyl-1,2,3,7,8,8a-hexahydroindolizine |
|---|---|
| PubChem CID | 10618615 |
| Molecular Formula | C21H31NO2S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | (8R,8aS)-8-methyl-6-(4-methylphenyl)sulfonyl-5-pentyl-1,2,3,7,8,8a-hexahydroindolizine |
| SMILES | CCCCCC1=C(S(=O)(=O)c2ccc(C)cc2)C[C@@H](C)[C@@H]2CCCN12 |
| InChI | InChI=1S/C21H31NO2S/c1-4-5-6-8-20-21(15-17(3)19-9-7-14-22(19)20)25(23,24)18-12-10-16(2)11-13-18/h10-13,17,19H,4-9,14-15H2,1-3H3/t17-,19+/m1/s1 |
| InChIKey | LETHYPJRRXSJIA-MJGOQNOKSA-N |
| XLogP | 5.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|