C17H27NO2S — CID 3419634
2-methyl-1-(4-pentylphenyl)sulfonylpiperidine (PubChem CID 3419634) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-methyl-1-(4-pentylphenyl)sulfonylpiperidine.
| Compound Name | 2-methyl-1-(4-pentylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 3419634 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-methyl-1-(4-pentylphenyl)sulfonylpiperidine |
| SMILES | CCCCCc1ccc(S(=O)(=O)N2CCCCC2C)cc1 |
| InChI | InChI=1S/C17H27NO2S/c1-3-4-5-9-16-10-12-17(13-11-16)21(19,20)18-14-7-6-8-15(18)2/h10-13,15H,3-9,14H2,1-2H3 |
| InChIKey | GCZOYMCTNTYEHI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|