C18H26N2O5S — CID 110291797
ethyl 2-[2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]ethylamino]-2-oxoacetate (PubChem CID 110291797) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is ethyl 2-[2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]ethylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]ethylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 110291797 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | ethyl 2-[2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]ethylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCCc1ccc(S(=O)(=O)N2CCCCC2C)cc1 |
| InChI | InChI=1S/C18H26N2O5S/c1-3-25-18(22)17(21)19-12-11-15-7-9-16(10-8-15)26(23,24)20-13-5-4-6-14(20)2/h7-10,14H,3-6,11-13H2,1-2H3,(H,19,21) |
| InChIKey | WSUUDHCFURKBJU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|