C19H31N3O3S — CID 110630199
1-butan-2-yl-3-[2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]ethyl]urea (PubChem CID 110630199) has the molecular formula C19H31N3O3S and a molecular weight of 381.54 g/mol. Its IUPAC name is 1-butan-2-yl-3-[2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]ethyl]urea.
| Compound Name | 1-butan-2-yl-3-[2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]ethyl]urea |
|---|---|
| PubChem CID | 110630199 |
| Molecular Formula | C19H31N3O3S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-butan-2-yl-3-[2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]ethyl]urea |
| SMILES | CCC(C)NC(=O)NCCc1ccc(S(=O)(=O)N2CCCCC2C)cc1 |
| InChI | InChI=1S/C19H31N3O3S/c1-4-15(2)21-19(23)20-13-12-17-8-10-18(11-9-17)26(24,25)22-14-6-5-7-16(22)3/h8-11,15-16H,4-7,12-14H2,1-3H3,(H2,20,21,23) |
| InChIKey | AWMSZEJSUKWDJX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |