C19H28N2O3S — CID 137340209
(3R,8aR)-3-methyl-2-(4-pentylphenyl)sulfonyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137340209) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is (3R,8aR)-3-methyl-2-(4-pentylphenyl)sulfonyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3R,8aR)-3-methyl-2-(4-pentylphenyl)sulfonyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137340209 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (3R,8aR)-3-methyl-2-(4-pentylphenyl)sulfonyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | CCCCCc1ccc(S(=O)(=O)N2C[C@H]3CCCN3C(=O)[C@H]2C)cc1 |
| InChI | InChI=1S/C19H28N2O3S/c1-3-4-5-7-16-9-11-18(12-10-16)25(23,24)21-14-17-8-6-13-20(17)19(22)15(21)2/h9-12,15,17H,3-8,13-14H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | KJVNSHNOFHTQTD-NVXWUHKLSA-N |
| XLogP | 2.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|